C12H11BrN2O2 — CID 89380473
4-bromo-N-[(Z)-2,3-dihydrofuran-5-ylmethylideneamino]benzamide (PubChem CID 89380473) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-2,3-dihydrofuran-5-ylmethylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(Z)-2,3-dihydrofuran-5-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 89380473 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 4-bromo-N-[(Z)-2,3-dihydrofuran-5-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C\C1=CCCO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H11BrN2O2/c13-10-5-3-9(4-6-10)12(16)15-14-8-11-2-1-7-17-11/h2-6,8H,1,7H2,(H,15,16)/b14-8- |
| InChIKey | ANPKIHAIRSKZJG-ZSOIEALJSA-N |
| XLogP | 2.47 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|