C18H14N4O9 — CID 70434049
bis(6H-[1,3]dioxolo[4,5-f]quinazoline-7,9-dione);hydrate (PubChem CID 70434049) has the molecular formula C18H14N4O9 and a molecular weight of 430.33 g/mol. Its IUPAC name is bis(6H-[1,3]dioxolo[4,5-f]quinazoline-7,9-dione);hydrate.
| Compound Name | bis(6H-[1,3]dioxolo[4,5-f]quinazoline-7,9-dione);hydrate |
|---|---|
| PubChem CID | 70434049 |
| Molecular Formula | C18H14N4O9 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | bis(6H-[1,3]dioxolo[4,5-f]quinazoline-7,9-dione);hydrate |
| SMILES | O.O=c1[nH]c(=O)c2c3c(ccc2[nH]1)OCO3.O=c1[nH]c(=O)c2c3c(ccc2[nH]1)OCO3 |
| InChI | InChI=1S/2C9H6N2O4.H2O/c2*12-8-6-4(10-9(13)11-8)1-2-5-7(6)15-3-14-5;/h2*1-2H,3H2,(H2,10,11,12,13);1H2 |
| InChIKey | RMLFWQGGUQMNKY-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 199.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |