C12H13NO2 — CID 153438844
7-propan-2-yl-6H-[1,3]dioxolo[4,5-e]indole (PubChem CID 153438844) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 7-propan-2-yl-6H-[1,3]dioxolo[4,5-e]indole.
| Compound Name | 7-propan-2-yl-6H-[1,3]dioxolo[4,5-e]indole |
|---|---|
| PubChem CID | 153438844 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 7-propan-2-yl-6H-[1,3]dioxolo[4,5-e]indole |
| SMILES | CC(C)c1cc2c3c(ccc2[nH]1)OCO3 |
| InChI | InChI=1S/C12H13NO2/c1-7(2)10-5-8-9(13-10)3-4-11-12(8)15-6-14-11/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | HKMJFDNSHXTPDT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |