C10H11FO5S — CID 151378928
4-fluorosulfonyloxy-5-propan-2-yl-1,3-benzodioxole (PubChem CID 151378928) has the molecular formula C10H11FO5S and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-fluorosulfonyloxy-5-propan-2-yl-1,3-benzodioxole.
| Compound Name | 4-fluorosulfonyloxy-5-propan-2-yl-1,3-benzodioxole |
|---|---|
| PubChem CID | 151378928 |
| Molecular Formula | C10H11FO5S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 4-fluorosulfonyloxy-5-propan-2-yl-1,3-benzodioxole |
| SMILES | CC(C)c1ccc2c(c1OS(=O)(=O)F)OCO2 |
| InChI | InChI=1S/C10H11FO5S/c1-6(2)7-3-4-8-10(15-5-14-8)9(7)16-17(11,12)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | ORZOLBHWKGQGOD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |