C16H25NO3 — CID 151761887
N,N-diethyl-1-[(5-propan-2-yl-1,3-benzodioxol-4-yl)oxy]ethanamine (PubChem CID 151761887) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N,N-diethyl-1-[(5-propan-2-yl-1,3-benzodioxol-4-yl)oxy]ethanamine.
| Compound Name | N,N-diethyl-1-[(5-propan-2-yl-1,3-benzodioxol-4-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 151761887 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N,N-diethyl-1-[(5-propan-2-yl-1,3-benzodioxol-4-yl)oxy]ethanamine |
| SMILES | CCN(CC)C(C)Oc1c(C(C)C)ccc2c1OCO2 |
| InChI | InChI=1S/C16H25NO3/c1-6-17(7-2)12(5)20-15-13(11(3)4)8-9-14-16(15)19-10-18-14/h8-9,11-12H,6-7,10H2,1-5H3 |
| InChIKey | RQSWHXKQJYPMCO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|