C10H8ClNO2 — CID 158173605
[1,3]dioxolo[4,5-h]isoquinolin-8-ium chloride (PubChem CID 158173605) has the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-h]isoquinolin-8-ium chloride.
| Compound Name | [1,3]dioxolo[4,5-h]isoquinolin-8-ium chloride |
|---|---|
| PubChem CID | 158173605 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | [1,3]dioxolo[4,5-h]isoquinolin-8-ium chloride |
| SMILES | [Cl-].c1cc2ccc3c(c2c[nH+]1)OCO3 |
| InChI | InChI=1S/C10H7NO2.ClH/c1-2-9-10(13-6-12-9)8-5-11-4-3-7(1)8;/h1-5H,6H2;1H |
| InChIKey | AGMBPUXTDZQRQT-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |