C9H6Cl2N2O3 — CID 19604225
5-(dichloromethoxy)-1H-quinazoline-2,4-dione (PubChem CID 19604225) has the molecular formula C9H6Cl2N2O3 and a molecular weight of 261.06 g/mol. Its IUPAC name is 5-(dichloromethoxy)-1H-quinazoline-2,4-dione.
| Compound Name | 5-(dichloromethoxy)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 19604225 |
| Molecular Formula | C9H6Cl2N2O3 |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 5-(dichloromethoxy)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2c(OC(Cl)Cl)cccc2[nH]1 |
| InChI | InChI=1S/C9H6Cl2N2O3/c10-8(11)16-5-3-1-2-4-6(5)7(14)13-9(15)12-4/h1-3,8H,(H2,12,13,14,15) |
| InChIKey | WQCOVXZSGQYWQF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|