2,4-dioxo-1H-quinazoline-5-sulfonyl chloride

C8H5ClN2O4S — CID 121398704

IUPAC2,4-dioxo-1H-quinazoline-5-sulfonyl chloride
SMILESO=c1[nH]c(=O)c2c(S(=O)(=O)Cl)cccc2[nH]1
InChIInChI=1S/C8H5ClN2O4S/c9-16(14,15)5-3-1-2-4-6(5)7(12)11-8(13)10-4/h1-3H,(H2,10,11,12,13)
InChIKeyWOQZZIBLTXFBGP-UHFFFAOYSA-N
MW260.66 g/mol
LogP0.14
Rot. Bonds1

About 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride

2,4-dioxo-1H-quinazoline-5-sulfonyl chloride (PubChem CID 121398704) has the molecular formula C8H5ClN2O4S and a molecular weight of 260.66 g/mol. Its IUPAC name is 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride.

Molecular Properties

Compound Name2,4-dioxo-1H-quinazoline-5-sulfonyl chloride
PubChem CID121398704
Molecular FormulaC8H5ClN2O4S
Molecular Weight260.66 g/mol
Exact Mass259.97
IUPAC Name2,4-dioxo-1H-quinazoline-5-sulfonyl chloride
SMILESO=c1[nH]c(=O)c2c(S(=O)(=O)Cl)cccc2[nH]1
InChIInChI=1S/C8H5ClN2O4S/c9-16(14,15)5-3-1-2-4-6(5)7(12)11-8(13)10-4/h1-3H,(H2,10,11,12,13)
InChIKeyWOQZZIBLTXFBGP-UHFFFAOYSA-N
XLogP0.14
TPSA99.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.66
LogP ≤ 50.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride?
The IUPAC name of 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride (CID 121398704) is 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride.
What is the SMILES notation for 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride?
The canonical SMILES for 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride is O=c1[nH]c(=O)c2c(S(=O)(=O)Cl)cccc2[nH]1.
What is the InChIKey of 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride?
The InChIKey is WOQZZIBLTXFBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O4S/c9-16(14,15)5-3-1-2-4-6(5)7(12)11-8(13)10-4/h1-3H,(H2,10,11,12,13).
What are the key properties of 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride?
2,4-dioxo-1H-quinazoline-5-sulfonyl chloride has a molecular weight of 260.66 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride is sourced from PubChem (CID 121398704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).