C8H5ClN2O4S — CID 121398704
2,4-dioxo-1H-quinazoline-5-sulfonyl chloride (PubChem CID 121398704) has the molecular formula C8H5ClN2O4S and a molecular weight of 260.66 g/mol. Its IUPAC name is 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride.
| Compound Name | 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride |
|---|---|
| PubChem CID | 121398704 |
| Molecular Formula | C8H5ClN2O4S |
| Molecular Weight | 260.66 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 2,4-dioxo-1H-quinazoline-5-sulfonyl chloride |
| SMILES | O=c1[nH]c(=O)c2c(S(=O)(=O)Cl)cccc2[nH]1 |
| InChI | InChI=1S/C8H5ClN2O4S/c9-16(14,15)5-3-1-2-4-6(5)7(12)11-8(13)10-4/h1-3H,(H2,10,11,12,13) |
| InChIKey | WOQZZIBLTXFBGP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.66 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |