C10H10N2O3 — CID 19604239
8-ethoxy-1H-quinazoline-2,4-dione (PubChem CID 19604239) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 8-ethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 8-ethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 19604239 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 8-ethoxy-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cccc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C10H10N2O3/c1-2-15-7-5-3-4-6-8(7)11-10(14)12-9(6)13/h3-5H,2H2,1H3,(H2,11,12,13,14) |
| InChIKey | BIBHKBCPICAQQA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |