About 7-ethoxy-1H-indol-3-ol
7-ethoxy-1H-indol-3-ol (PubChem CID 137437163) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 7-ethoxy-1H-indol-3-ol.
Molecular Properties
| Compound Name | 7-ethoxy-1H-indol-3-ol |
| PubChem CID | 137437163 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 7-ethoxy-1H-indol-3-ol |
| SMILES | CCOc1cccc2c(O)c[nH]c12 |
| InChI | InChI=1S/C10H11NO2/c1-2-13-9-5-3-4-7-8(12)6-11-10(7)9/h3-6,11-12H,2H2,1H3 |
| InChIKey | ZMEDDXYPOXLNMH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethoxy-1H-indol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-1H-indol-3-ol?
The IUPAC name of 7-ethoxy-1H-indol-3-ol (CID 137437163) is 7-ethoxy-1H-indol-3-ol.
What is the SMILES notation for 7-ethoxy-1H-indol-3-ol?
The canonical SMILES for 7-ethoxy-1H-indol-3-ol is CCOc1cccc2c(O)c[nH]c12.
What is the InChIKey of 7-ethoxy-1H-indol-3-ol?
The InChIKey is ZMEDDXYPOXLNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-2-13-9-5-3-4-7-8(12)6-11-10(7)9/h3-6,11-12H,2H2,1H3.
What are the key properties of 7-ethoxy-1H-indol-3-ol?
7-ethoxy-1H-indol-3-ol has a molecular weight of 177.20 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-1H-indol-3-ol is sourced from PubChem (CID 137437163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).