C20H16O4 — CID 158637985
1,3-benzodioxole-4-carboxylic acid;1,1'-biphenyl (PubChem CID 158637985) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1,3-benzodioxole-4-carboxylic acid;1,1'-biphenyl.
| Compound Name | 1,3-benzodioxole-4-carboxylic acid;1,1'-biphenyl |
|---|---|
| PubChem CID | 158637985 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1,3-benzodioxole-4-carboxylic acid;1,1'-biphenyl |
| SMILES | O=C(O)c1cccc2c1OCO2.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H6O4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-8(10)5-2-1-3-6-7(5)12-4-11-6/h1-10H;1-3H,4H2,(H,9,10) |
| InChIKey | HZZXRYHTEYOJGC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |