C13H16O6 — CID 65175519
6-(3-ethoxypropoxy)-1,3-benzodioxole-5-carboxylic acid (PubChem CID 65175519) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is 6-(3-ethoxypropoxy)-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | 6-(3-ethoxypropoxy)-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 65175519 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 6-(3-ethoxypropoxy)-1,3-benzodioxole-5-carboxylic acid |
| SMILES | CCOCCCOc1cc2c(cc1C(=O)O)OCO2 |
| InChI | InChI=1S/C13H16O6/c1-2-16-4-3-5-17-10-7-12-11(18-8-19-12)6-9(10)13(14)15/h6-7H,2-5,8H2,1H3,(H,14,15) |
| InChIKey | AIJGGUYMPLQTFZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|