C14H18O7 — CID 103179970
6-[2-(3-methoxypropoxy)ethoxy]-1,3-benzodioxole-5-carboxylic acid (PubChem CID 103179970) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is 6-[2-(3-methoxypropoxy)ethoxy]-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | 6-[2-(3-methoxypropoxy)ethoxy]-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 103179970 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 6-[2-(3-methoxypropoxy)ethoxy]-1,3-benzodioxole-5-carboxylic acid |
| SMILES | COCCCOCCOc1cc2c(cc1C(=O)O)OCO2 |
| InChI | InChI=1S/C14H18O7/c1-17-3-2-4-18-5-6-19-11-8-13-12(20-9-21-13)7-10(11)14(15)16/h7-8H,2-6,9H2,1H3,(H,15,16) |
| InChIKey | AYJMEQOVEOHLBU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|