C14H21NO5 — CID 103400876
6-[3-(2-methoxyethoxy)propoxy]-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 103400876) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 6-[3-(2-methoxyethoxy)propoxy]-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-[3-(2-methoxyethoxy)propoxy]-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 103400876 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 6-[3-(2-methoxyethoxy)propoxy]-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | COCCOCCCOc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C14H21NO5/c1-16-5-6-17-3-2-4-18-12-10-14-13(9-11(12)15)19-7-8-20-14/h9-10H,2-8,15H2,1H3 |
| InChIKey | QVMPPBKUYIAZHF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|