About 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid
6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid (PubChem CID 54979334) has the molecular formula C12H9NO6
and a molecular weight of 263.20 g/mol. Its IUPAC name is 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid.
Analyze 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
The IUPAC name of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid (CID 54979334) is 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid.
What is the SMILES notation for 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
The canonical SMILES for 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid is O=C(O)c1cc2c(cc1OCc1cnoc1)OCO2.
What is the InChIKey of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
The InChIKey is IBWBHBZHIQFWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO6/c14-12(15)8-1-10-11(18-6-17-10)2-9(8)16-4-7-3-13-19-5-7/h1-3,5H,4,6H2,(H,14,15).
What are the key properties of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid has a molecular weight of 263.20 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid is sourced from PubChem (CID 54979334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).