6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid

C12H9NO6 — CID 54979334

IUPAC6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid
SMILESO=C(O)c1cc2c(cc1OCc1cnoc1)OCO2
InChIInChI=1S/C12H9NO6/c14-12(15)8-1-10-11(18-6-17-10)2-9(8)16-4-7-3-13-19-5-7/h1-3,5H,4,6H2,(H,14,15)
InChIKeyIBWBHBZHIQFWFN-UHFFFAOYSA-N
MW263.20 g/mol
LogP1.68
Rot. Bonds4

About 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid

6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid (PubChem CID 54979334) has the molecular formula C12H9NO6 and a molecular weight of 263.20 g/mol. Its IUPAC name is 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid.

Molecular Properties

Compound Name6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid
PubChem CID54979334
Molecular FormulaC12H9NO6
Molecular Weight263.20 g/mol
Exact Mass263.04
IUPAC Name6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid
SMILESO=C(O)c1cc2c(cc1OCc1cnoc1)OCO2
InChIInChI=1S/C12H9NO6/c14-12(15)8-1-10-11(18-6-17-10)2-9(8)16-4-7-3-13-19-5-7/h1-3,5H,4,6H2,(H,14,15)
InChIKeyIBWBHBZHIQFWFN-UHFFFAOYSA-N
XLogP1.68
TPSA91.02 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.20
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
The IUPAC name of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid (CID 54979334) is 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid.
What is the SMILES notation for 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
The canonical SMILES for 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid is O=C(O)c1cc2c(cc1OCc1cnoc1)OCO2.
What is the InChIKey of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
The InChIKey is IBWBHBZHIQFWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO6/c14-12(15)8-1-10-11(18-6-17-10)2-9(8)16-4-7-3-13-19-5-7/h1-3,5H,4,6H2,(H,14,15).
What are the key properties of 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid?
6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid has a molecular weight of 263.20 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2-oxazol-4-ylmethoxy)-1,3-benzodioxole-5-carboxylic acid is sourced from PubChem (CID 54979334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).