1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid

C15H11NO4 — CID 61223878

IUPAC1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid
SMILESO=C(O)c1ccc2ccccc2c1OCc1cnoc1
InChIInChI=1S/C15H11NO4/c17-15(18)13-6-5-11-3-1-2-4-12(11)14(13)19-8-10-7-16-20-9-10/h1-7,9H,8H2,(H,17,18)
InChIKeyKLCYWHSZPUBEAN-UHFFFAOYSA-N
MW269.26 g/mol
LogP3.11
Rot. Bonds4

About 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid

1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid (PubChem CID 61223878) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid
PubChem CID61223878
Molecular FormulaC15H11NO4
Molecular Weight269.26 g/mol
Exact Mass269.07
IUPAC Name1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid
SMILESO=C(O)c1ccc2ccccc2c1OCc1cnoc1
InChIInChI=1S/C15H11NO4/c17-15(18)13-6-5-11-3-1-2-4-12(11)14(13)19-8-10-7-16-20-9-10/h1-7,9H,8H2,(H,17,18)
InChIKeyKLCYWHSZPUBEAN-UHFFFAOYSA-N
XLogP3.11
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.26
LogP ≤ 53.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid?
The IUPAC name of 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid (CID 61223878) is 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid.
What is the SMILES notation for 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid?
The canonical SMILES for 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid is O=C(O)c1ccc2ccccc2c1OCc1cnoc1.
What is the InChIKey of 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid?
The InChIKey is KLCYWHSZPUBEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO4/c17-15(18)13-6-5-11-3-1-2-4-12(11)14(13)19-8-10-7-16-20-9-10/h1-7,9H,8H2,(H,17,18).
What are the key properties of 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid?
1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid has a molecular weight of 269.26 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-oxazol-4-ylmethoxy)naphthalene-2-carboxylic acid is sourced from PubChem (CID 61223878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).