C23H23N2O3S+ — CID 9291659
N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 9291659) has the molecular formula C23H23N2O3S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 9291659 |
| Molecular Formula | C23H23N2O3S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | O=C(C[NH+]1CCc2sccc2[C@H]1c1ccccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H22N2O3S/c26-22(24-13-16-6-7-19-20(12-16)28-15-27-19)14-25-10-8-21-18(9-11-29-21)23(25)17-4-2-1-3-5-17/h1-7,9,11-12,23H,8,10,13-15H2,(H,24,26)/p+1/t23-/m1/s1 |
| InChIKey | WOBSGZGQRRQQPW-HSZRJFAPSA-O |
| XLogP | 2.32 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |