C25H28N3OS+ — CID 9296888
2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 9296888) has the molecular formula C25H28N3OS+ and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 9296888 |
| Molecular Formula | C25H28N3OS+ |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[(4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(C[NH+]1CCc2sccc2[C@H]1c1ccccc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C25H27N3OS/c29-24(26-20-8-10-21(11-9-20)27-14-4-5-15-27)18-28-16-12-23-22(13-17-30-23)25(28)19-6-2-1-3-7-19/h1-3,6-11,13,17,25H,4-5,12,14-16,18H2,(H,26,29)/p+1/t25-/m1/s1 |
| InChIKey | PGIMBXLFXUMACA-RUZDIDTESA-O |
| XLogP | 3.52 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|