C18H25N4OS3+ — CID 9320934
N-cyclopropyl-N-[4-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 9320934) has the molecular formula C18H25N4OS3+ and a molecular weight of 409.63 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[4-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 9320934 |
| Molecular Formula | C18H25N4OS3+ |
| Molecular Weight | 409.63 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-cyclopropyl-N-[4-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nn(C[NH+]2CCc3sccc3[C@@H]2CC)c(=S)s1)C1CC1 |
| InChI | InChI=1S/C18H24N4OS3/c1-3-14-13-8-10-25-15(13)7-9-20(14)11-21-18(24)26-17(19-21)22(12-5-6-12)16(23)4-2/h8,10,12,14H,3-7,9,11H2,1-2H3/p+1/t14-/m0/s1 |
| InChIKey | PERBVYLNBNIYQE-AWEZNQCLSA-O |
| XLogP | 3.19 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|