C15H23N3O5S — CID 9236283
methyl 1-[[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]methyl]piperidine-4-carboxylate (PubChem CID 9236283) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is methyl 1-[[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9236283 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methyl 1-[[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cn2cc(S(=O)(=O)N(C)C)ccc2=O)CC1 |
| InChI | InChI=1S/C15H23N3O5S/c1-16(2)24(21,22)13-4-5-14(19)18(10-13)11-17-8-6-12(7-9-17)15(20)23-3/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | QUTQDUJKAHRUJR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |