C22H20N2O2S2 — CID 9325280
5-ethyl-1-[[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]indole-2,3-dione (PubChem CID 9325280) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 5-ethyl-1-[[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]indole-2,3-dione.
| Compound Name | 5-ethyl-1-[[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9325280 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 5-ethyl-1-[[(4R)-4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]indole-2,3-dione |
| SMILES | CCc1ccc2c(c1)C(=O)C(=O)N2CN1CCc2sccc2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C22H20N2O2S2/c1-2-14-5-6-17-16(12-14)21(25)22(26)24(17)13-23-9-7-18-15(8-11-28-18)20(23)19-4-3-10-27-19/h3-6,8,10-12,20H,2,7,9,13H2,1H3/t20-/m1/s1 |
| InChIKey | YSZYECADUQGYAO-HXUWFJFHSA-N |
| XLogP | 4.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|