C21H24FN3O3+2 — CID 9325347
5-fluoro-1-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione (PubChem CID 9325347) has the molecular formula C21H24FN3O3+2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 5-fluoro-1-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione.
| Compound Name | 5-fluoro-1-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9325347 |
| Molecular Formula | C21H24FN3O3+2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 5-fluoro-1-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione |
| SMILES | COc1ccc(C[NH+]2CC[NH+](CN3C(=O)C(=O)c4cc(F)ccc43)CC2)cc1 |
| InChI | InChI=1S/C21H22FN3O3/c1-28-17-5-2-15(3-6-17)13-23-8-10-24(11-9-23)14-25-19-7-4-16(22)12-18(19)20(26)21(25)27/h2-7,12H,8-11,13-14H2,1H3/p+2 |
| InChIKey | ZYFPBUOMGVMYTH-UHFFFAOYSA-P |
| XLogP | -0.70 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|