C21H22BNO4 — CID 112747255
1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-2,3-dione (PubChem CID 112747255) has the molecular formula C21H22BNO4 and a molecular weight of 363.22 g/mol. Its IUPAC name is 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-2,3-dione.
| Compound Name | 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 112747255 |
| Molecular Formula | C21H22BNO4 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-2,3-dione |
| SMILES | CC1(C)OB(c2ccccc2CN2C(=O)C(=O)c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C21H22BNO4/c1-20(2)21(3,4)27-22(26-20)16-11-7-5-9-14(16)13-23-17-12-8-6-10-15(17)18(24)19(23)25/h5-12H,13H2,1-4H3 |
| InChIKey | GLXFXYLUWVGBCR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|