C15H8F3NO2 — CID 129218578
1-[(3,4,5-trifluorophenyl)methyl]indole-2,3-dione (PubChem CID 129218578) has the molecular formula C15H8F3NO2 and a molecular weight of 291.23 g/mol. Its IUPAC name is 1-[(3,4,5-trifluorophenyl)methyl]indole-2,3-dione.
| Compound Name | 1-[(3,4,5-trifluorophenyl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 129218578 |
| Molecular Formula | C15H8F3NO2 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-[(3,4,5-trifluorophenyl)methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cc(F)c(F)c(F)c2)c2ccccc21 |
| InChI | InChI=1S/C15H8F3NO2/c16-10-5-8(6-11(17)13(10)18)7-19-12-4-2-1-3-9(12)14(20)15(19)21/h1-6H,7H2 |
| InChIKey | MZEQHEARASBXDA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|