C15H12F3N3O5 — CID 8776788
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 8776788) has the molecular formula C15H12F3N3O5 and a molecular weight of 371.27 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 8776788 |
| Molecular Formula | C15H12F3N3O5 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cn1ccc(=O)[nH]c1=O)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H12F3N3O5/c1-7(14(24)19-9-3-2-8(16)12(17)13(9)18)26-11(23)6-21-5-4-10(22)20-15(21)25/h2-5,7H,6H2,1H3,(H,19,24)(H,20,22,25)/t7-/m1/s1 |
| InChIKey | GDXSDIJJKFKAJZ-SSDOTTSWSA-N |
| XLogP | 0.52 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|