C15H13F3N2O4S — CID 30261686
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 30261686) has the molecular formula C15H13F3N2O4S and a molecular weight of 374.34 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
|---|---|
| PubChem CID | 30261686 |
| Molecular Formula | C15H13F3N2O4S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | Cc1csc(=O)n1CC(=O)O[C@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H13F3N2O4S/c1-7-6-25-15(23)20(7)5-11(21)24-8(2)14(22)19-10-4-3-9(16)12(17)13(10)18/h3-4,6,8H,5H2,1-2H3,(H,19,22)/t8-/m1/s1 |
| InChIKey | XZZVEIUECPBCPH-MRVPVSSYSA-N |
| XLogP | 2.21 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|