C22H16N2O5 — CID 2276147
[2-(naphthalen-1-ylamino)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 2276147) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 2276147 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)C(=O)c2ccccc21)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H16N2O5/c25-19(23-17-10-5-7-14-6-1-2-8-15(14)17)13-29-20(26)12-24-18-11-4-3-9-16(18)21(27)22(24)28/h1-11H,12-13H2,(H,23,25) |
| InChIKey | VSUZFFBYHCEKEA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|