C19H19ClN2O5 — CID 21175651
[2-(3-chloroanilino)-2-oxoethyl] 2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate (PubChem CID 21175651) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
|---|---|
| PubChem CID | 21175651 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
| SMILES | O=C(COC(=O)CN1C(=O)[C@H]2[C@@H]3CC[C@H](C3)[C@@H]2C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN2O5/c20-12-2-1-3-13(7-12)21-14(23)9-27-15(24)8-22-18(25)16-10-4-5-11(6-10)17(16)19(22)26/h1-3,7,10-11,16-17H,4-6,8-9H2,(H,21,23)/t10-,11-,16+,17+/m1/s1 |
| InChIKey | GYDDFBYSGVJPPN-BBHZHJQOSA-N |
| XLogP | 1.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|