C20H21ClN2O5 — CID 11945405
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate (PubChem CID 11945405) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
|---|---|
| PubChem CID | 11945405 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CN2C(=O)[C@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C2=O)cc1Cl |
| InChI | InChI=1S/C20H21ClN2O5/c1-10-2-5-13(7-14(10)21)22-15(24)9-28-16(25)8-23-19(26)17-11-3-4-12(6-11)18(17)20(23)27/h2,5,7,11-12,17-18H,3-4,6,8-9H2,1H3,(H,22,24)/t11-,12+,17-,18-/m0/s1 |
| InChIKey | SSSQEOHCCBZFOS-CMKMFDCUSA-N |
| XLogP | 2.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|