C24H36N2O4 — CID 8708975
[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 8708975) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 8708975 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)COC(=O)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H36N2O4/c1-6-26(7-2)22(28)17-10-14-20(15-11-17)25-21(27)16-30-23(29)18-8-12-19(13-9-18)24(3,4)5/h10-11,14-15,18-19H,6-9,12-13,16H2,1-5H3,(H,25,27) |
| InChIKey | LBTMAPUMMSRGJU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |