C36H34NO5P — CID 10817237
ethyl (4S)-4-(1,3-dioxoisoindol-2-yl)-5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)heptanoate (PubChem CID 10817237) has the molecular formula C36H34NO5P and a molecular weight of 591.64 g/mol. Its IUPAC name is ethyl (4S)-4-(1,3-dioxoisoindol-2-yl)-5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)heptanoate.
| Compound Name | ethyl (4S)-4-(1,3-dioxoisoindol-2-yl)-5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)heptanoate |
|---|---|
| PubChem CID | 10817237 |
| Molecular Formula | C36H34NO5P |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | ethyl (4S)-4-(1,3-dioxoisoindol-2-yl)-5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)heptanoate |
| SMILES | CCOC(=O)C(C(=O)[C@H](C(C)CC)N1C(=O)c2ccccc2C1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H34NO5P/c1-4-25(3)31(37-34(39)29-23-15-16-24-30(29)35(37)40)32(38)33(36(41)42-5-2)43(26-17-9-6-10-18-26,27-19-11-7-12-20-27)28-21-13-8-14-22-28/h6-25,31H,4-5H2,1-3H3/t25?,31-/m0/s1 |
| InChIKey | AUUMMUNMLYGPNU-KHTLXAHUSA-N |
| XLogP | 5.00 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|