C21H20BrNO4 — CID 19170258
(4-bromo-3-methylphenyl) 2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate (PubChem CID 19170258) has the molecular formula C21H20BrNO4 and a molecular weight of 430.30 g/mol. Its IUPAC name is (4-bromo-3-methylphenyl) 2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate.
| Compound Name | (4-bromo-3-methylphenyl) 2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 19170258 |
| Molecular Formula | C21H20BrNO4 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | (4-bromo-3-methylphenyl) 2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
| SMILES | CCC(C)C(C(=O)Oc1ccc(Br)c(C)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20BrNO4/c1-4-12(2)18(21(26)27-14-9-10-17(22)13(3)11-14)23-19(24)15-7-5-6-8-16(15)20(23)25/h5-12,18H,4H2,1-3H3 |
| InChIKey | IHDZPLNCAVCGAF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|