C23H25NO4S — CID 8886668
(3-methyl-4-propan-2-ylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 8886668) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is (3-methyl-4-propan-2-ylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | (3-methyl-4-propan-2-ylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 8886668 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (3-methyl-4-propan-2-ylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)Oc1ccc(C(C)C)c(C)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H25NO4S/c1-14(2)17-10-9-16(13-15(17)3)28-23(27)20(11-12-29-4)24-21(25)18-7-5-6-8-19(18)22(24)26/h5-10,13-14,20H,11-12H2,1-4H3/t20-/m1/s1 |
| InChIKey | AINLDEGCBKHLSN-HXUWFJFHSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|