C20H18ClNO4S — CID 7698673
(4-chloro-2-methylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 7698673) has the molecular formula C20H18ClNO4S and a molecular weight of 403.89 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | (4-chloro-2-methylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7698673 |
| Molecular Formula | C20H18ClNO4S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (4-chloro-2-methylphenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)Oc1ccc(Cl)cc1C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18ClNO4S/c1-12-11-13(21)7-8-17(12)26-20(25)16(9-10-27-2)22-18(23)14-5-3-4-6-15(14)19(22)24/h3-8,11,16H,9-10H2,1-2H3/t16-/m1/s1 |
| InChIKey | CXEUBUNJNDAHER-MRXNPFEDSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|