C19H17ClN2O3S — CID 2925840
N-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 2925840) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | N-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 2925840 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(C(=O)Nc1ccc(Cl)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H17ClN2O3S/c1-26-11-10-16(17(23)21-13-8-6-12(20)7-9-13)22-18(24)14-4-2-3-5-15(14)19(22)25/h2-9,16H,10-11H2,1H3,(H,21,23) |
| InChIKey | YSYYLPXONKHDTM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|