C19H16F2N2O3S — CID 2711432
(2R)-N-(2,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 2711432) has the molecular formula C19H16F2N2O3S and a molecular weight of 390.41 g/mol. Its IUPAC name is (2R)-N-(2,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-N-(2,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 2711432 |
| Molecular Formula | C19H16F2N2O3S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (2R)-N-(2,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](C(=O)Nc1cc(F)ccc1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16F2N2O3S/c1-27-9-8-16(17(24)22-15-10-11(20)6-7-14(15)21)23-18(25)12-4-2-3-5-13(12)19(23)26/h2-7,10,16H,8-9H2,1H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | IXJRLECOEKGROX-MRXNPFEDSA-N |
| XLogP | 3.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|