C18H24N2O3S — CID 2666840
(2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-pentan-3-ylbutanamide (PubChem CID 2666840) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-pentan-3-ylbutanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-pentan-3-ylbutanamide |
|---|---|
| PubChem CID | 2666840 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-pentan-3-ylbutanamide |
| SMILES | CCC(CC)NC(=O)[C@H](CCSC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H24N2O3S/c1-4-12(5-2)19-16(21)15(10-11-24-3)20-17(22)13-8-6-7-9-14(13)18(20)23/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | BIAZFUZRYYWWNI-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|