C17H17N3O3S2 — CID 2679372
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 2679372) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2679372 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | CSCC[C@H](C(=O)Nc1nc(C)cs1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H17N3O3S2/c1-10-9-25-17(18-10)19-14(21)13(7-8-24-2)20-15(22)11-5-3-4-6-12(11)16(20)23/h3-6,9,13H,7-8H2,1-2H3,(H,18,19,21)/t13-/m1/s1 |
| InChIKey | NRXHOIRCFMKTCU-CYBMUJFWSA-N |
| XLogP | 2.81 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|