C16H17N3O3S2 — CID 2095523
(2R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 2095523) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 2095523 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (2R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](C(=O)NC1=NCCS1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H17N3O3S2/c1-23-8-6-12(13(20)18-16-17-7-9-24-16)19-14(21)10-4-2-3-5-11(10)15(19)22/h2-5,12H,6-9H2,1H3,(H,17,18,20)/t12-/m1/s1 |
| InChIKey | CSWJWAUMOHBVKM-GFCCVEGCSA-N |
| XLogP | 1.62 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|