C22H22N2O3S — CID 7920772
(2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 7920772) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 7920772 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](C(=O)Nc1ccc2c(c1)CCC2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22N2O3S/c1-28-12-11-19(24-21(26)17-7-2-3-8-18(17)22(24)27)20(25)23-16-10-9-14-5-4-6-15(14)13-16/h2-3,7-10,13,19H,4-6,11-12H2,1H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | BDUDQNDTMHJSQY-IBGZPJMESA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|