C23H26N2O3S — CID 7914320
(2S)-N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 7914320) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is (2S)-N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 7914320 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2S)-N-(4-tert-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](C(=O)Nc1ccc(C(C)(C)C)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H26N2O3S/c1-23(2,3)15-9-11-16(12-10-15)24-20(26)19(13-14-29-4)25-21(27)17-7-5-6-8-18(17)22(25)28/h5-12,19H,13-14H2,1-4H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | XTPIWHBMYLMTGG-IBGZPJMESA-N |
| XLogP | 4.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|