C21H20N2O3S — CID 9141965
(2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanamide (PubChem CID 9141965) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanamide.
| Compound Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 9141965 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanamide |
| SMILES | CSC[C@H](C(=O)Nc1ccc2c(c1)CCC2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20N2O3S/c1-27-12-18(23-20(25)16-7-2-3-8-17(16)21(23)26)19(24)22-15-10-9-13-5-4-6-14(13)11-15/h2-3,7-11,18H,4-6,12H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | ONCNMHNYULCRJN-GOSISDBHSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|