C19H15ClN2O5S — CID 41094779
4-chloro-2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoyl]amino]benzoic acid (PubChem CID 41094779) has the molecular formula C19H15ClN2O5S and a molecular weight of 418.86 g/mol. Its IUPAC name is 4-chloro-2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 41094779 |
| Molecular Formula | C19H15ClN2O5S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 4-chloro-2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoyl]amino]benzoic acid |
| SMILES | CSC[C@H](C(=O)Nc1cc(Cl)ccc1C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15ClN2O5S/c1-28-9-15(22-17(24)11-4-2-3-5-12(11)18(22)25)16(23)21-14-8-10(20)6-7-13(14)19(26)27/h2-8,15H,9H2,1H3,(H,21,23)(H,26,27)/t15-/m1/s1 |
| InChIKey | LYICBFPMRXKLIL-OAHLLOKOSA-N |
| XLogP | 3.00 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|