C24H27N3O3S — CID 2397067
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(2-piperidin-1-ylphenyl)butanamide (PubChem CID 2397067) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(2-piperidin-1-ylphenyl)butanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(2-piperidin-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 2397067 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanyl-N-(2-piperidin-1-ylphenyl)butanamide |
| SMILES | CSCC[C@H](C(=O)Nc1ccccc1N1CCCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H27N3O3S/c1-31-16-13-21(27-23(29)17-9-3-4-10-18(17)24(27)30)22(28)25-19-11-5-6-12-20(19)26-14-7-2-8-15-26/h3-6,9-12,21H,2,7-8,13-16H2,1H3,(H,25,28)/t21-/m1/s1 |
| InChIKey | KBLQOVXQEAPDET-OAQYLSRUSA-N |
| XLogP | 4.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|