C18H24N2O4S — CID 110839282
2-(1,3-dioxoisoindol-2-yl)-N-(5-hydroxypentyl)-4-methylsulfanylbutanamide (PubChem CID 110839282) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(5-hydroxypentyl)-4-methylsulfanylbutanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-hydroxypentyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 110839282 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-hydroxypentyl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(C(=O)NCCCCCO)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H24N2O4S/c1-25-12-9-15(16(22)19-10-5-2-6-11-21)20-17(23)13-7-3-4-8-14(13)18(20)24/h3-4,7-8,15,21H,2,5-6,9-12H2,1H3,(H,19,22) |
| InChIKey | LUBHHMQCKZAPSD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|