C7H8F2N2O3 — CID 171313434
(1R)-3,3-difluoro-1-(5-nitrofuran-2-yl)propan-1-amine (PubChem CID 171313434) has the molecular formula C7H8F2N2O3 and a molecular weight of 206.15 g/mol. Its IUPAC name is (1R)-3,3-difluoro-1-(5-nitrofuran-2-yl)propan-1-amine.
| Compound Name | (1R)-3,3-difluoro-1-(5-nitrofuran-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 171313434 |
| Molecular Formula | C7H8F2N2O3 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (1R)-3,3-difluoro-1-(5-nitrofuran-2-yl)propan-1-amine |
| SMILES | N[C@H](CC(F)F)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C7H8F2N2O3/c8-6(9)3-4(10)5-1-2-7(14-5)11(12)13/h1-2,4,6H,3,10H2/t4-/m1/s1 |
| InChIKey | XSMVQZDGCGAQNR-SCSAIBSYSA-N |
| XLogP | 1.84 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|