C12H16ClFN2O6 — CID 171251821
ethyl (3S)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxy-5-nitrophenyl)propanoate;hydrochloride (PubChem CID 171251821) has the molecular formula C12H16ClFN2O6 and a molecular weight of 338.72 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxy-5-nitrophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxy-5-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171251821 |
| Molecular Formula | C12H16ClFN2O6 |
| Molecular Weight | 338.72 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxy-5-nitrophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1cc([N+](=O)[O-])cc(OC)c1O.Cl |
| InChI | InChI=1S/C12H15FN2O6.ClH/c1-3-21-12(17)9(13)10(14)7-4-6(15(18)19)5-8(20-2)11(7)16;/h4-5,9-10,16H,3,14H2,1-2H3;1H/t9?,10-;/m0./s1 |
| InChIKey | GXAAUBFEEVSDCW-FTCYEJDNSA-N |
| XLogP | 1.63 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.72 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|