C17H19Br — CID 63442341
1-[bromo-(2,5-dimethylphenyl)methyl]-2,3-dimethylbenzene (PubChem CID 63442341) has the molecular formula C17H19Br and a molecular weight of 303.24 g/mol. Its IUPAC name is 1-[bromo-(2,5-dimethylphenyl)methyl]-2,3-dimethylbenzene.
| Compound Name | 1-[bromo-(2,5-dimethylphenyl)methyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 63442341 |
| Molecular Formula | C17H19Br |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-[bromo-(2,5-dimethylphenyl)methyl]-2,3-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C(Br)c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C17H19Br/c1-11-8-9-13(3)16(10-11)17(18)15-7-5-6-12(2)14(15)4/h5-10,17H,1-4H3 |
| InChIKey | YATGTYDTZVKZIM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|