C16H18FN — CID 43198585
1-(2,5-dimethylphenyl)-2-(4-fluorophenyl)ethanamine (PubChem CID 43198585) has the molecular formula C16H18FN and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(4-fluorophenyl)ethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 43198585 |
| Molecular Formula | C16H18FN |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(4-fluorophenyl)ethanamine |
| SMILES | Cc1ccc(C)c(C(N)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H18FN/c1-11-3-4-12(2)15(9-11)16(18)10-13-5-7-14(17)8-6-13/h3-9,16H,10,18H2,1-2H3 |
| InChIKey | ZYOWZQOABNQDLK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |