C12H16O2S — CID 64637617
3-(2,4-dimethylphenyl)sulfinylbutan-2-one (PubChem CID 64637617) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)sulfinylbutan-2-one.
| Compound Name | 3-(2,4-dimethylphenyl)sulfinylbutan-2-one |
|---|---|
| PubChem CID | 64637617 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 3-(2,4-dimethylphenyl)sulfinylbutan-2-one |
| SMILES | CC(=O)C(C)S(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C12H16O2S/c1-8-5-6-12(9(2)7-8)15(14)11(4)10(3)13/h5-7,11H,1-4H3 |
| InChIKey | LPLCQJZIUNVXRZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |